C27H40O5 — CID 91173364
propan-2-yl 7-[(1R,2R)-3,5-dihydroxy-2-[3-hydroxy-5-(4-methylphenyl)pent-1-enyl]cyclopentyl]hept-5-enoate (PubChem CID 91173364) has the molecular formula C27H40O5 and a molecular weight of 444.61 g/mol. Its IUPAC name is propan-2-yl 7-[(1R,2R)-3,5-dihydroxy-2-[3-hydroxy-5-(4-methylphenyl)pent-1-enyl]cyclopentyl]hept-5-enoate.
| Compound Name | propan-2-yl 7-[(1R,2R)-3,5-dihydroxy-2-[3-hydroxy-5-(4-methylphenyl)pent-1-enyl]cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 91173364 |
| Molecular Formula | C27H40O5 |
| Molecular Weight | 444.61 g/mol |
| Exact Mass | 444.29 |
| IUPAC Name | propan-2-yl 7-[(1R,2R)-3,5-dihydroxy-2-[3-hydroxy-5-(4-methylphenyl)pent-1-enyl]cyclopentyl]hept-5-enoate |
| SMILES | Cc1ccc(CCC(O)C=C[C@H]2C(O)CC(O)[C@@H]2CC=CCCCC(=O)OC(C)C)cc1 |
| InChI | InChI=1S/C27H40O5/c1-19(2)32-27(31)9-7-5-4-6-8-23-24(26(30)18-25(23)29)17-16-22(28)15-14-21-12-10-20(3)11-13-21/h4,6,10-13,16-17,19,22-26,28-30H,5,7-9,14-15,18H2,1-3H3/t22?,23-,24-,25?,26?/m1/s1 |
| InChIKey | QUUNZYPWVVSZBV-KRVJYSKNSA-N |
| XLogP | 4.27 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.61 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|