C24H34O5 — CID 22628718
(E)-8-[3,5-dihydroxy-2-[(E)-3-hydroxy-5-phenylpent-1-enyl]cyclopentyl]-1-hydroxyoct-6-en-2-one (PubChem CID 22628718) has the molecular formula C24H34O5 and a molecular weight of 402.53 g/mol. Its IUPAC name is (E)-8-[3,5-dihydroxy-2-[(E)-3-hydroxy-5-phenylpent-1-enyl]cyclopentyl]-1-hydroxyoct-6-en-2-one.
| Compound Name | (E)-8-[3,5-dihydroxy-2-[(E)-3-hydroxy-5-phenylpent-1-enyl]cyclopentyl]-1-hydroxyoct-6-en-2-one |
|---|---|
| PubChem CID | 22628718 |
| Molecular Formula | C24H34O5 |
| Molecular Weight | 402.53 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | (E)-8-[3,5-dihydroxy-2-[(E)-3-hydroxy-5-phenylpent-1-enyl]cyclopentyl]-1-hydroxyoct-6-en-2-one |
| SMILES | O=C(CO)CCC/C=C/CC1C(O)CC(O)C1/C=C/C(O)CCc1ccccc1 |
| InChI | InChI=1S/C24H34O5/c25-17-20(27)10-6-1-2-7-11-21-22(24(29)16-23(21)28)15-14-19(26)13-12-18-8-4-3-5-9-18/h2-5,7-9,14-15,19,21-26,28-29H,1,6,10-13,16-17H2/b7-2+,15-14+ |
| InChIKey | GBUBKLGNYVDUFB-CVMDFWICSA-N |
| XLogP | 2.57 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.53 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|