C31H38O6 — CID 118634038
[(Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxy-5-phenylpent-1-enyl]cyclopentyl]hept-5-enoyl] 2-prop-2-ynylpent-4-ynoate (PubChem CID 118634038) has the molecular formula C31H38O6 and a molecular weight of 506.64 g/mol. Its IUPAC name is [(Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxy-5-phenylpent-1-enyl]cyclopentyl]hept-5-enoyl] 2-prop-2-ynylpent-4-ynoate.
| Compound Name | [(Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxy-5-phenylpent-1-enyl]cyclopentyl]hept-5-enoyl] 2-prop-2-ynylpent-4-ynoate |
|---|---|
| PubChem CID | 118634038 |
| Molecular Formula | C31H38O6 |
| Molecular Weight | 506.64 g/mol |
| Exact Mass | 506.27 |
| IUPAC Name | [(Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxy-5-phenylpent-1-enyl]cyclopentyl]hept-5-enoyl] 2-prop-2-ynylpent-4-ynoate |
| SMILES | C#CCC(CC#C)C(=O)OC(=O)CCC/C=C\C[C@@H]1[C@@H](/C=C/[C@@H](O)CCc2ccccc2)[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C31H38O6/c1-3-12-24(13-4-2)31(36)37-30(35)17-11-6-5-10-16-26-27(29(34)22-28(26)33)21-20-25(32)19-18-23-14-8-7-9-15-23/h1-2,5,7-10,14-15,20-21,24-29,32-34H,6,11-13,16-19,22H2/b10-5-,21-20+/t25-,26+,27+,28-,29+/m0/s1 |
| InChIKey | MWCBKJZRSMYWPZ-GCZQZSOTSA-N |
| XLogP | 3.74 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.64 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|