C26H38O5 — CID 59099651
butyl (Z)-7-[(3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxy-4-phenylbut-1-enyl]cyclopentyl]hept-5-enoate (PubChem CID 59099651) has the molecular formula C26H38O5 and a molecular weight of 430.59 g/mol. Its IUPAC name is butyl (Z)-7-[(3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxy-4-phenylbut-1-enyl]cyclopentyl]hept-5-enoate.
| Compound Name | butyl (Z)-7-[(3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxy-4-phenylbut-1-enyl]cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 59099651 |
| Molecular Formula | C26H38O5 |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.27 |
| IUPAC Name | butyl (Z)-7-[(3R,5S)-3,5-dihydroxy-2-[(E,3S)-3-hydroxy-4-phenylbut-1-enyl]cyclopentyl]hept-5-enoate |
| SMILES | CCCCOC(=O)CCC/C=C\CC1C(/C=C/[C@@H](O)Cc2ccccc2)[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C26H38O5/c1-2-3-17-31-26(30)14-10-5-4-9-13-22-23(25(29)19-24(22)28)16-15-21(27)18-20-11-7-6-8-12-20/h4,6-9,11-12,15-16,21-25,27-29H,2-3,5,10,13-14,17-19H2,1H3/b9-4-,16-15+/t21-,22?,23?,24+,25-/m1/s1 |
| InChIKey | AWMKQAZGXVMUCB-LKMOAHFDSA-N |
| XLogP | 3.96 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|