C24H32O6 — CID 6434686
methyl (Z)-7-[(2R)-3,5-dihydroxy-2-[(E,3S)-3-hydroxy-5-oxo-5-phenylpent-1-enyl]cyclopentyl]hept-5-enoate (PubChem CID 6434686) has the molecular formula C24H32O6 and a molecular weight of 416.51 g/mol. Its IUPAC name is methyl (Z)-7-[(2R)-3,5-dihydroxy-2-[(E,3S)-3-hydroxy-5-oxo-5-phenylpent-1-enyl]cyclopentyl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[(2R)-3,5-dihydroxy-2-[(E,3S)-3-hydroxy-5-oxo-5-phenylpent-1-enyl]cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 6434686 |
| Molecular Formula | C24H32O6 |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | methyl (Z)-7-[(2R)-3,5-dihydroxy-2-[(E,3S)-3-hydroxy-5-oxo-5-phenylpent-1-enyl]cyclopentyl]hept-5-enoate |
| SMILES | COC(=O)CCC/C=C\CC1C(O)CC(O)[C@@H]1/C=C/[C@@H](O)CC(=O)c1ccccc1 |
| InChI | InChI=1S/C24H32O6/c1-30-24(29)12-8-3-2-7-11-19-20(23(28)16-22(19)27)14-13-18(25)15-21(26)17-9-5-4-6-10-17/h2,4-7,9-10,13-14,18-20,22-23,25,27-28H,3,8,11-12,15-16H2,1H3/b7-2-,14-13+/t18-,19?,20-,22?,23?/m1/s1 |
| InChIKey | WNJHWPYDCCZEFR-ASYGLCARSA-N |
| XLogP | 2.82 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|