C26H36O6 — CID 164511264
methyl (Z)-7-[3,5-dihydroxy-2-[(E)-2-[2-(2-phenylethyl)-1,3-dioxolan-2-yl]ethenyl]cyclopentyl]hept-5-enoate (PubChem CID 164511264) has the molecular formula C26H36O6 and a molecular weight of 444.57 g/mol. Its IUPAC name is methyl (Z)-7-[3,5-dihydroxy-2-[(E)-2-[2-(2-phenylethyl)-1,3-dioxolan-2-yl]ethenyl]cyclopentyl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[3,5-dihydroxy-2-[(E)-2-[2-(2-phenylethyl)-1,3-dioxolan-2-yl]ethenyl]cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 164511264 |
| Molecular Formula | C26H36O6 |
| Molecular Weight | 444.57 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | methyl (Z)-7-[3,5-dihydroxy-2-[(E)-2-[2-(2-phenylethyl)-1,3-dioxolan-2-yl]ethenyl]cyclopentyl]hept-5-enoate |
| SMILES | COC(=O)CCC/C=C\CC1C(O)CC(O)C1/C=C/C1(CCc2ccccc2)OCCO1 |
| InChI | InChI=1S/C26H36O6/c1-30-25(29)12-8-3-2-7-11-21-22(24(28)19-23(21)27)14-16-26(31-17-18-32-26)15-13-20-9-5-4-6-10-20/h2,4-7,9-10,14,16,21-24,27-28H,3,8,11-13,15,17-19H2,1H3/b7-2-,16-14+ |
| InChIKey | MOXKRXTYMMXBFO-RUKMVQBUSA-N |
| XLogP | 3.57 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.57 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|