C26H33F3O7 — CID 24838619
methyl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E)-2-[2-[[4-(trifluoromethyl)phenoxy]methyl]-1,3-dioxolan-2-yl]ethenyl]cyclopentyl]hept-5-enoate (PubChem CID 24838619) has the molecular formula C26H33F3O7 and a molecular weight of 514.54 g/mol. Its IUPAC name is methyl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E)-2-[2-[[4-(trifluoromethyl)phenoxy]methyl]-1,3-dioxolan-2-yl]ethenyl]cyclopentyl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E)-2-[2-[[4-(trifluoromethyl)phenoxy]methyl]-1,3-dioxolan-2-yl]ethenyl]cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 24838619 |
| Molecular Formula | C26H33F3O7 |
| Molecular Weight | 514.54 g/mol |
| Exact Mass | 514.22 |
| IUPAC Name | methyl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E)-2-[2-[[4-(trifluoromethyl)phenoxy]methyl]-1,3-dioxolan-2-yl]ethenyl]cyclopentyl]hept-5-enoate |
| SMILES | COC(=O)CCC/C=C\C[C@@H]1[C@@H](/C=C/C2(COc3ccc(C(F)(F)F)cc3)OCCO2)[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C26H33F3O7/c1-33-24(32)7-5-3-2-4-6-20-21(23(31)16-22(20)30)12-13-25(35-14-15-36-25)17-34-19-10-8-18(9-11-19)26(27,28)29/h2,4,8-13,20-23,30-31H,3,5-7,14-17H2,1H3/b4-2-,13-12+/t20-,21-,22+,23-/m1/s1 |
| InChIKey | AAMAHWCSHPVJDE-LVNBPTOYSA-N |
| XLogP | 4.03 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.54 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|