C26H34F3IO6 — CID 73108303
propan-2-yl 7-[3,5-dihydroxy-2-[3-hydroxy-4-[2-iodo-5-(trifluoromethyl)phenoxy]but-1-enyl]cyclopentyl]hept-5-enoate (PubChem CID 73108303) has the molecular formula C26H34F3IO6 and a molecular weight of 626.45 g/mol. Its IUPAC name is propan-2-yl 7-[3,5-dihydroxy-2-[3-hydroxy-4-[2-iodo-5-(trifluoromethyl)phenoxy]but-1-enyl]cyclopentyl]hept-5-enoate.
| Compound Name | propan-2-yl 7-[3,5-dihydroxy-2-[3-hydroxy-4-[2-iodo-5-(trifluoromethyl)phenoxy]but-1-enyl]cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 73108303 |
| Molecular Formula | C26H34F3IO6 |
| Molecular Weight | 626.45 g/mol |
| Exact Mass | 626.14 |
| IUPAC Name | propan-2-yl 7-[3,5-dihydroxy-2-[3-hydroxy-4-[2-iodo-5-(trifluoromethyl)phenoxy]but-1-enyl]cyclopentyl]hept-5-enoate |
| SMILES | CC(C)OC(=O)CCCC=CCC1C(O)CC(O)C1C=CC(O)COc1cc(C(F)(F)F)ccc1I |
| InChI | InChI=1S/C26H34F3IO6/c1-16(2)36-25(34)8-6-4-3-5-7-19-20(23(33)14-22(19)32)11-10-18(31)15-35-24-13-17(26(27,28)29)9-12-21(24)30/h3,5,9-13,16,18-20,22-23,31-33H,4,6-8,14-15H2,1-2H3 |
| InChIKey | UQTXPNADGAHXKJ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.45 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|