C24H32ClFO4 — CID 59878882
(1S,2R,3R,4S)-3-[(E)-2-[2-[(3-chlorophenoxy)methyl]-1,3-dioxolan-2-yl]ethenyl]-4-fluoro-2-[(Z)-hept-2-enyl]cyclopentan-1-ol (PubChem CID 59878882) has the molecular formula C24H32ClFO4 and a molecular weight of 438.97 g/mol. Its IUPAC name is (1S,2R,3R,4S)-3-[(E)-2-[2-[(3-chlorophenoxy)methyl]-1,3-dioxolan-2-yl]ethenyl]-4-fluoro-2-[(Z)-hept-2-enyl]cyclopentan-1-ol.
| Compound Name | (1S,2R,3R,4S)-3-[(E)-2-[2-[(3-chlorophenoxy)methyl]-1,3-dioxolan-2-yl]ethenyl]-4-fluoro-2-[(Z)-hept-2-enyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 59878882 |
| Molecular Formula | C24H32ClFO4 |
| Molecular Weight | 438.97 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | (1S,2R,3R,4S)-3-[(E)-2-[2-[(3-chlorophenoxy)methyl]-1,3-dioxolan-2-yl]ethenyl]-4-fluoro-2-[(Z)-hept-2-enyl]cyclopentan-1-ol |
| SMILES | CCCC/C=C\C[C@@H]1[C@@H](/C=C/C2(COc3cccc(Cl)c3)OCCO2)[C@@H](F)C[C@@H]1O |
| InChI | InChI=1S/C24H32ClFO4/c1-2-3-4-5-6-10-21-20(22(26)16-23(21)27)11-12-24(29-13-14-30-24)17-28-19-9-7-8-18(25)15-19/h5-9,11-12,15,20-23,27H,2-4,10,13-14,16-17H2,1H3/b6-5-,12-11+/t20-,21-,22+,23+/m1/s1 |
| InChIKey | BHUZTJKKYNDPMZ-CHELKOQZSA-N |
| XLogP | 5.49 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.97 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|