C19H22ClO6P — CID 91214292
(3aR,4R)-4-[2-[2-[(3-chlorophenoxy)methyl]-1,3-dioxolan-2-yl]ethenyl]-5-phosphanyloxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 91214292) has the molecular formula C19H22ClO6P and a molecular weight of 412.81 g/mol. Its IUPAC name is (3aR,4R)-4-[2-[2-[(3-chlorophenoxy)methyl]-1,3-dioxolan-2-yl]ethenyl]-5-phosphanyloxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (3aR,4R)-4-[2-[2-[(3-chlorophenoxy)methyl]-1,3-dioxolan-2-yl]ethenyl]-5-phosphanyloxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 91214292 |
| Molecular Formula | C19H22ClO6P |
| Molecular Weight | 412.81 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | (3aR,4R)-4-[2-[2-[(3-chlorophenoxy)methyl]-1,3-dioxolan-2-yl]ethenyl]-5-phosphanyloxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | O=C1C[C@H]2C(CC(OP)[C@@H]2C=CC2(COc3cccc(Cl)c3)OCCO2)O1 |
| InChI | InChI=1S/C19H22ClO6P/c20-12-2-1-3-13(8-12)22-11-19(23-6-7-24-19)5-4-14-15-9-18(21)25-16(15)10-17(14)26-27/h1-5,8,14-17H,6-7,9-11,27H2/t14-,15-,16?,17?/m1/s1 |
| InChIKey | GXYZKLRTSAARKH-NUWOQIAWSA-N |
| XLogP | 3.14 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.81 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|