C35H41ClO6Si — CID 22951510
(3aR,4R,5R,6aS)-5-[tert-butyl(diphenyl)silyl]oxy-4-[2-[2-[(3-chlorophenoxy)methyl]-1,3-dioxolan-2-yl]ethyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 22951510) has the molecular formula C35H41ClO6Si and a molecular weight of 621.25 g/mol. Its IUPAC name is (3aR,4R,5R,6aS)-5-[tert-butyl(diphenyl)silyl]oxy-4-[2-[2-[(3-chlorophenoxy)methyl]-1,3-dioxolan-2-yl]ethyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (3aR,4R,5R,6aS)-5-[tert-butyl(diphenyl)silyl]oxy-4-[2-[2-[(3-chlorophenoxy)methyl]-1,3-dioxolan-2-yl]ethyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 22951510 |
| Molecular Formula | C35H41ClO6Si |
| Molecular Weight | 621.25 g/mol |
| Exact Mass | 620.24 |
| IUPAC Name | (3aR,4R,5R,6aS)-5-[tert-butyl(diphenyl)silyl]oxy-4-[2-[2-[(3-chlorophenoxy)methyl]-1,3-dioxolan-2-yl]ethyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | CC(C)(C)[Si](O[C@@H]1C[C@@H]2OC(=O)C[C@@H]2[C@H]1CCC1(COc2cccc(Cl)c2)OCCO1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H41ClO6Si/c1-34(2,3)43(27-13-6-4-7-14-27,28-15-8-5-9-16-28)42-32-23-31-30(22-33(37)41-31)29(32)17-18-35(39-19-20-40-35)24-38-26-12-10-11-25(36)21-26/h4-16,21,29-32H,17-20,22-24H2,1-3H3/t29-,30-,31+,32-/m1/s1 |
| InChIKey | XSVYAYIRIKHWDX-FEFKUCBWSA-N |
| XLogP | 6.14 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.25 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|