C18H21F3O5P2 — CID 90858086
(3aR,4R)-5-phosphanyloxy-4-[3-phosphanyloxy-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 90858086) has the molecular formula C18H21F3O5P2 and a molecular weight of 436.30 g/mol. Its IUPAC name is (3aR,4R)-5-phosphanyloxy-4-[3-phosphanyloxy-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (3aR,4R)-5-phosphanyloxy-4-[3-phosphanyloxy-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 90858086 |
| Molecular Formula | C18H21F3O5P2 |
| Molecular Weight | 436.30 g/mol |
| Exact Mass | 436.08 |
| IUPAC Name | (3aR,4R)-5-phosphanyloxy-4-[3-phosphanyloxy-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | O=C1C[C@H]2C(CC(OP)[C@@H]2C=CC(COc2cccc(C(F)(F)F)c2)OP)O1 |
| InChI | InChI=1S/C18H21F3O5P2/c19-18(20,21)10-2-1-3-11(6-10)23-9-12(25-27)4-5-13-14-7-17(22)24-15(14)8-16(13)26-28/h1-6,12-16H,7-9,27-28H2/t12?,13-,14-,15?,16?/m1/s1 |
| InChIKey | IKCOVADRTXPFOH-BNCAHLNWSA-N |
| XLogP | 3.94 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.30 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|