C18H20BF3O5P2 — CID 58604104
(3aR,4S,5R,6aS)-5-bis(phosphanyl)boranyloxy-4-[(E)-3-oxo-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 58604104) has the molecular formula C18H20BF3O5P2 and a molecular weight of 446.11 g/mol. Its IUPAC name is (3aR,4S,5R,6aS)-5-bis(phosphanyl)boranyloxy-4-[(E)-3-oxo-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (3aR,4S,5R,6aS)-5-bis(phosphanyl)boranyloxy-4-[(E)-3-oxo-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 58604104 |
| Molecular Formula | C18H20BF3O5P2 |
| Molecular Weight | 446.11 g/mol |
| Exact Mass | 446.08 |
| IUPAC Name | (3aR,4S,5R,6aS)-5-bis(phosphanyl)boranyloxy-4-[(E)-3-oxo-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | O=C(/C=C/[C@H]1[C@H]2CC(=O)O[C@H]2C[C@H]1OB(P)P)COc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H20BF3O5P2/c20-18(21,22)10-2-1-3-12(6-10)25-9-11(23)4-5-13-14-7-17(24)26-15(14)8-16(13)27-19(28)29/h1-6,13-16H,7-9,28-29H2/b5-4+/t13-,14+,15-,16+/m0/s1 |
| InChIKey | GVVCQHZNLIEOPE-RMQMOJESSA-N |
| XLogP | 3.28 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.11 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|