C33H29F3NO5+ — CID 163612982
(E)-4-[(3aR,5R,6aS)-2-oxo-5-(4-phenylbenzoyl)oxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-4-yl]-N-methyl-2-[[3-(trifluoromethyl)phenoxy]methyl]but-3-enenitrilium (PubChem CID 163612982) has the molecular formula C33H29F3NO5+ and a molecular weight of 576.59 g/mol. Its IUPAC name is (E)-4-[(3aR,5R,6aS)-2-oxo-5-(4-phenylbenzoyl)oxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-4-yl]-N-methyl-2-[[3-(trifluoromethyl)phenoxy]methyl]but-3-enenitrilium.
| Compound Name | (E)-4-[(3aR,5R,6aS)-2-oxo-5-(4-phenylbenzoyl)oxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-4-yl]-N-methyl-2-[[3-(trifluoromethyl)phenoxy]methyl]but-3-enenitrilium |
|---|---|
| PubChem CID | 163612982 |
| Molecular Formula | C33H29F3NO5+ |
| Molecular Weight | 576.59 g/mol |
| Exact Mass | 576.20 |
| IUPAC Name | (E)-4-[(3aR,5R,6aS)-2-oxo-5-(4-phenylbenzoyl)oxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-4-yl]-N-methyl-2-[[3-(trifluoromethyl)phenoxy]methyl]but-3-enenitrilium |
| SMILES | C[N+]#CC(/C=C/C1[C@H]2CC(=O)O[C@H]2C[C@H]1OC(=O)c1ccc(-c2ccccc2)cc1)COc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C33H29F3NO5/c1-37-19-21(20-40-26-9-5-8-25(16-26)33(34,35)36)10-15-27-28-17-31(38)41-30(28)18-29(27)42-32(39)24-13-11-23(12-14-24)22-6-3-2-4-7-22/h2-16,21,27-30H,17-18,20H2,1H3/q+1/b15-10+/t21?,27?,28-,29-,30+/m1/s1 |
| InChIKey | QCQYTWYIYLWARD-JHDKSHLMSA-N |
| XLogP | 7.06 |
| TPSA | 66.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.59 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|