C31H36O5 — CID 22899317
[(3aR,4R,5R,6aS)-4-[(E,3S)-5-cyclohexyl-3-hydroxypent-1-enyl]-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] 4-phenylbenzoate (PubChem CID 22899317) has the molecular formula C31H36O5 and a molecular weight of 488.62 g/mol. Its IUPAC name is [(3aR,4R,5R,6aS)-4-[(E,3S)-5-cyclohexyl-3-hydroxypent-1-enyl]-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] 4-phenylbenzoate.
| Compound Name | [(3aR,4R,5R,6aS)-4-[(E,3S)-5-cyclohexyl-3-hydroxypent-1-enyl]-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] 4-phenylbenzoate |
|---|---|
| PubChem CID | 22899317 |
| Molecular Formula | C31H36O5 |
| Molecular Weight | 488.62 g/mol |
| Exact Mass | 488.26 |
| IUPAC Name | [(3aR,4R,5R,6aS)-4-[(E,3S)-5-cyclohexyl-3-hydroxypent-1-enyl]-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] 4-phenylbenzoate |
| SMILES | O=C1C[C@@H]2[C@@H](/C=C/[C@@H](O)CCC3CCCCC3)[C@H](OC(=O)c3ccc(-c4ccccc4)cc3)C[C@@H]2O1 |
| InChI | InChI=1S/C31H36O5/c32-25(16-11-21-7-3-1-4-8-21)17-18-26-27-19-30(33)35-29(27)20-28(26)36-31(34)24-14-12-23(13-15-24)22-9-5-2-6-10-22/h2,5-6,9-10,12-15,17-18,21,25-29,32H,1,3-4,7-8,11,16,19-20H2/b18-17+/t25-,26+,27+,28+,29-/m0/s1 |
| InChIKey | FEYJWWMKFPNPFH-UAFSWDGMSA-N |
| XLogP | 6.11 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.62 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|