C31H29BrO5 — CID 10099361
[(3aR,4R,5R,6aS)-4-[(E,3S)-5-(3-bromophenyl)-3-hydroxypent-1-enyl]-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] 4-phenylbenzoate (PubChem CID 10099361) has the molecular formula C31H29BrO5 and a molecular weight of 561.47 g/mol. Its IUPAC name is [(3aR,4R,5R,6aS)-4-[(E,3S)-5-(3-bromophenyl)-3-hydroxypent-1-enyl]-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] 4-phenylbenzoate.
| Compound Name | [(3aR,4R,5R,6aS)-4-[(E,3S)-5-(3-bromophenyl)-3-hydroxypent-1-enyl]-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] 4-phenylbenzoate |
|---|---|
| PubChem CID | 10099361 |
| Molecular Formula | C31H29BrO5 |
| Molecular Weight | 561.47 g/mol |
| Exact Mass | 560.12 |
| IUPAC Name | [(3aR,4R,5R,6aS)-4-[(E,3S)-5-(3-bromophenyl)-3-hydroxypent-1-enyl]-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] 4-phenylbenzoate |
| SMILES | O=C1C[C@@H]2[C@@H](/C=C/[C@@H](O)CCc3cccc(Br)c3)[C@H](OC(=O)c3ccc(-c4ccccc4)cc3)C[C@@H]2O1 |
| InChI | InChI=1S/C31H29BrO5/c32-24-8-4-5-20(17-24)9-14-25(33)15-16-26-27-18-30(34)36-29(27)19-28(26)37-31(35)23-12-10-22(11-13-23)21-6-2-1-3-7-21/h1-8,10-13,15-17,25-29,33H,9,14,18-19H2/b16-15+/t25-,26+,27+,28+,29-/m0/s1 |
| InChIKey | SPBAIRWPNDHWOA-ZSMDYZMDSA-N |
| XLogP | 6.14 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.47 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|