C37H44O5Si — CID 67006167
[(3aR,4R,5S,6aS)-4-[(E,3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-phenylpent-1-enyl]-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] 4-phenylbenzoate (PubChem CID 67006167) has the molecular formula C37H44O5Si and a molecular weight of 596.84 g/mol. Its IUPAC name is [(3aR,4R,5S,6aS)-4-[(E,3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-phenylpent-1-enyl]-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] 4-phenylbenzoate.
| Compound Name | [(3aR,4R,5S,6aS)-4-[(E,3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-phenylpent-1-enyl]-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] 4-phenylbenzoate |
|---|---|
| PubChem CID | 67006167 |
| Molecular Formula | C37H44O5Si |
| Molecular Weight | 596.84 g/mol |
| Exact Mass | 596.30 |
| IUPAC Name | [(3aR,4R,5S,6aS)-4-[(E,3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-phenylpent-1-enyl]-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] 4-phenylbenzoate |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H](/C=C/[C@@H]1[C@H]2CC(=O)O[C@H]2C[C@@H]1OC(=O)c1ccc(-c2ccccc2)cc1)CCc1ccccc1 |
| InChI | InChI=1S/C37H44O5Si/c1-37(2,3)43(4,5)42-30(21-16-26-12-8-6-9-13-26)22-23-31-32-24-35(38)40-34(32)25-33(31)41-36(39)29-19-17-28(18-20-29)27-14-10-7-11-15-27/h6-15,17-20,22-23,30-34H,16,21,24-25H2,1-5H3/b23-22+/t30-,31-,32-,33+,34+/m1/s1 |
| InChIKey | JKHADYMACPRLAF-LCJROZLRSA-N |
| XLogP | 8.41 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.84 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|