C32H29NO8 — CID 56639645
[(E,3S)-1-[(3aR,4R,5R,6aS)-5-benzoyloxy-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-4-yl]-5-phenylpent-1-en-3-yl] 4-nitrobenzoate (PubChem CID 56639645) has the molecular formula C32H29NO8 and a molecular weight of 555.58 g/mol. Its IUPAC name is [(E,3S)-1-[(3aR,4R,5R,6aS)-5-benzoyloxy-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-4-yl]-5-phenylpent-1-en-3-yl] 4-nitrobenzoate.
| Compound Name | [(E,3S)-1-[(3aR,4R,5R,6aS)-5-benzoyloxy-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-4-yl]-5-phenylpent-1-en-3-yl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 56639645 |
| Molecular Formula | C32H29NO8 |
| Molecular Weight | 555.58 g/mol |
| Exact Mass | 555.19 |
| IUPAC Name | [(E,3S)-1-[(3aR,4R,5R,6aS)-5-benzoyloxy-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-4-yl]-5-phenylpent-1-en-3-yl] 4-nitrobenzoate |
| SMILES | O=C1C[C@@H]2[C@@H](/C=C/[C@H](CCc3ccccc3)OC(=O)c3ccc([N+](=O)[O-])cc3)[C@H](OC(=O)c3ccccc3)C[C@@H]2O1 |
| InChI | InChI=1S/C32H29NO8/c34-30-19-27-26(28(20-29(27)40-30)41-32(36)22-9-5-2-6-10-22)18-17-25(16-11-21-7-3-1-4-8-21)39-31(35)23-12-14-24(15-13-23)33(37)38/h1-10,12-15,17-18,25-29H,11,16,19-20H2/b18-17+/t25-,26+,27+,28+,29-/m0/s1 |
| InChIKey | LATNFMZDQABZGT-UAFSWDGMSA-N |
| XLogP | 5.49 |
| TPSA | 122.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.58 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|