C23H27FO5 — CID 57210301
[(3aS,4S,5S)-4-[(3R)-3-(1-fluorocyclohexyl)-3-hydroxyprop-1-enyl]-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] benzoate (PubChem CID 57210301) has the molecular formula C23H27FO5 and a molecular weight of 402.46 g/mol. Its IUPAC name is [(3aS,4S,5S)-4-[(3R)-3-(1-fluorocyclohexyl)-3-hydroxyprop-1-enyl]-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] benzoate.
| Compound Name | [(3aS,4S,5S)-4-[(3R)-3-(1-fluorocyclohexyl)-3-hydroxyprop-1-enyl]-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] benzoate |
|---|---|
| PubChem CID | 57210301 |
| Molecular Formula | C23H27FO5 |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | [(3aS,4S,5S)-4-[(3R)-3-(1-fluorocyclohexyl)-3-hydroxyprop-1-enyl]-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] benzoate |
| SMILES | O=C1C[C@@H]2C(C[C@H](OC(=O)c3ccccc3)[C@H]2C=C[C@@H](O)C2(F)CCCCC2)O1 |
| InChI | InChI=1S/C23H27FO5/c24-23(11-5-2-6-12-23)20(25)10-9-16-17-13-21(26)28-19(17)14-18(16)29-22(27)15-7-3-1-4-8-15/h1,3-4,7-10,16-20,25H,2,5-6,11-14H2/t16-,17-,18-,19?,20+/m0/s1 |
| InChIKey | NJPRMGOZVFGJCR-JEAWMAPJSA-N |
| XLogP | 3.75 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|