C22H25ClO5 — CID 88699255
[(4R,5R)-4-[(1E,3S,6Z)-7-chloro-3-hydroxyocta-1,6-dienyl]-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] benzoate (PubChem CID 88699255) has the molecular formula C22H25ClO5 and a molecular weight of 404.89 g/mol. Its IUPAC name is [(4R,5R)-4-[(1E,3S,6Z)-7-chloro-3-hydroxyocta-1,6-dienyl]-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] benzoate.
| Compound Name | [(4R,5R)-4-[(1E,3S,6Z)-7-chloro-3-hydroxyocta-1,6-dienyl]-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] benzoate |
|---|---|
| PubChem CID | 88699255 |
| Molecular Formula | C22H25ClO5 |
| Molecular Weight | 404.89 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | [(4R,5R)-4-[(1E,3S,6Z)-7-chloro-3-hydroxyocta-1,6-dienyl]-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] benzoate |
| SMILES | C/C(Cl)=C/CC[C@H](O)/C=C/[C@@H]1C2CC(=O)OC2C[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C22H25ClO5/c1-14(23)6-5-9-16(24)10-11-17-18-12-21(25)27-20(18)13-19(17)28-22(26)15-7-3-2-4-8-15/h2-4,6-8,10-11,16-20,24H,5,9,12-13H2,1H3/b11-10+,14-6-/t16-,17+,18?,19+,20?/m0/s1 |
| InChIKey | QDOJCJUAIARWNR-HNDIICKISA-N |
| XLogP | 4.00 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.89 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|