C23H28O5 — CID 12070863
[(3aR,4R,5R,6aS)-4-[(E,3S)-3-cyclohexyl-3-hydroxyprop-1-enyl]-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] benzoate (PubChem CID 12070863) has the molecular formula C23H28O5 and a molecular weight of 384.47 g/mol. Its IUPAC name is [(3aR,4R,5R,6aS)-4-[(E,3S)-3-cyclohexyl-3-hydroxyprop-1-enyl]-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] benzoate.
| Compound Name | [(3aR,4R,5R,6aS)-4-[(E,3S)-3-cyclohexyl-3-hydroxyprop-1-enyl]-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] benzoate |
|---|---|
| PubChem CID | 12070863 |
| Molecular Formula | C23H28O5 |
| Molecular Weight | 384.47 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | [(3aR,4R,5R,6aS)-4-[(E,3S)-3-cyclohexyl-3-hydroxyprop-1-enyl]-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] benzoate |
| SMILES | O=C1C[C@@H]2[C@@H](/C=C/[C@@H](O)C3CCCCC3)[C@H](OC(=O)c3ccccc3)C[C@@H]2O1 |
| InChI | InChI=1S/C23H28O5/c24-19(15-7-3-1-4-8-15)12-11-17-18-13-22(25)27-21(18)14-20(17)28-23(26)16-9-5-2-6-10-16/h2,5-6,9-12,15,17-21,24H,1,3-4,7-8,13-14H2/b12-11+/t17-,18-,19-,20-,21+/m1/s1 |
| InChIKey | QCJYRKUJPBCFRJ-VCGAFJJDSA-N |
| XLogP | 3.66 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.47 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|