C23H28O5 — CID 20672798
[4-[(E)-4-methyl-3-oxooct-1-enyl]-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] benzoate (PubChem CID 20672798) has the molecular formula C23H28O5 and a molecular weight of 384.47 g/mol. Its IUPAC name is [4-[(E)-4-methyl-3-oxooct-1-enyl]-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] benzoate.
| Compound Name | [4-[(E)-4-methyl-3-oxooct-1-enyl]-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] benzoate |
|---|---|
| PubChem CID | 20672798 |
| Molecular Formula | C23H28O5 |
| Molecular Weight | 384.47 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | [4-[(E)-4-methyl-3-oxooct-1-enyl]-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] benzoate |
| SMILES | CCCCC(C)C(=O)/C=C/C1C(OC(=O)c2ccccc2)CC2OC(=O)CC21 |
| InChI | InChI=1S/C23H28O5/c1-3-4-8-15(2)19(24)12-11-17-18-13-22(25)27-21(18)14-20(17)28-23(26)16-9-6-5-7-10-16/h5-7,9-12,15,17-18,20-21H,3-4,8,13-14H2,1-2H3/b12-11+ |
| InChIKey | GOCNRMVMQSWTCL-VAWYXSNFSA-N |
| XLogP | 4.12 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.47 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|