C28H40O6Si — CID 68865237
[4-[4-[tert-butyl(dimethyl)silyl]oxy-3-oxooct-1-enyl]-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] benzoate (PubChem CID 68865237) has the molecular formula C28H40O6Si and a molecular weight of 500.71 g/mol. Its IUPAC name is [4-[4-[tert-butyl(dimethyl)silyl]oxy-3-oxooct-1-enyl]-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] benzoate.
| Compound Name | [4-[4-[tert-butyl(dimethyl)silyl]oxy-3-oxooct-1-enyl]-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] benzoate |
|---|---|
| PubChem CID | 68865237 |
| Molecular Formula | C28H40O6Si |
| Molecular Weight | 500.71 g/mol |
| Exact Mass | 500.26 |
| IUPAC Name | [4-[4-[tert-butyl(dimethyl)silyl]oxy-3-oxooct-1-enyl]-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] benzoate |
| SMILES | CCCCC(O[Si](C)(C)C(C)(C)C)C(=O)C=CC1C(OC(=O)c2ccccc2)CC2OC(=O)CC21 |
| InChI | InChI=1S/C28H40O6Si/c1-7-8-14-23(34-35(5,6)28(2,3)4)22(29)16-15-20-21-17-26(30)32-25(21)18-24(20)33-27(31)19-12-10-9-11-13-19/h9-13,15-16,20-21,23-25H,7-8,14,17-18H2,1-6H3 |
| InChIKey | KGIKPRXXSAUQJX-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.71 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|