C18H26BO4P3 — CID 20821710
5-bis(phosphanyl)boranyloxy-4-[(E)-5-phenyl-3-phosphanyloxypent-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 20821710) has the molecular formula C18H26BO4P3 and a molecular weight of 410.14 g/mol. Its IUPAC name is 5-bis(phosphanyl)boranyloxy-4-[(E)-5-phenyl-3-phosphanyloxypent-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | 5-bis(phosphanyl)boranyloxy-4-[(E)-5-phenyl-3-phosphanyloxypent-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 20821710 |
| Molecular Formula | C18H26BO4P3 |
| Molecular Weight | 410.14 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | 5-bis(phosphanyl)boranyloxy-4-[(E)-5-phenyl-3-phosphanyloxypent-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | O=C1CC2C(CC(OB(P)P)C2/C=C/C(CCc2ccccc2)OP)O1 |
| InChI | InChI=1S/C18H26BO4P3/c20-18-10-15-14(17(22-19(24)25)11-16(15)21-18)9-8-13(23-26)7-6-12-4-2-1-3-5-12/h1-5,8-9,13-17H,6-7,10-11,24-26H2/b9-8+ |
| InChIKey | ATMZEMITJCRMIZ-CMDGGOBGSA-N |
| XLogP | 3.42 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.14 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|