C18H25BO4P2 — CID 91401543
(3aR,4R,5R,6aS)-5-bis(phosphanyl)boranyloxy-4-(3-hydroxy-5-phenylpent-1-enyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 91401543) has the molecular formula C18H25BO4P2 and a molecular weight of 378.15 g/mol. Its IUPAC name is (3aR,4R,5R,6aS)-5-bis(phosphanyl)boranyloxy-4-(3-hydroxy-5-phenylpent-1-enyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (3aR,4R,5R,6aS)-5-bis(phosphanyl)boranyloxy-4-(3-hydroxy-5-phenylpent-1-enyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 91401543 |
| Molecular Formula | C18H25BO4P2 |
| Molecular Weight | 378.15 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | (3aR,4R,5R,6aS)-5-bis(phosphanyl)boranyloxy-4-(3-hydroxy-5-phenylpent-1-enyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | O=C1C[C@@H]2[C@@H](C=CC(O)CCc3ccccc3)[C@H](OB(P)P)C[C@@H]2O1 |
| InChI | InChI=1S/C18H25BO4P2/c20-13(7-6-12-4-2-1-3-5-12)8-9-14-15-10-18(21)22-16(15)11-17(14)23-19(24)25/h1-5,8-9,13-17,20H,6-7,10-11,24-25H2/t13?,14-,15-,16+,17-/m1/s1 |
| InChIKey | IUIXIYPYGWPTKM-MUOSFQKXSA-N |
| XLogP | 2.61 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.15 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|