C18H24BO4P2 — CID 88928181
CID 88928181 (PubChem CID 88928181) has the molecular formula C18H24BO4P2 and a molecular weight of 377.15 g/mol.
| Compound Name | CID 88928181 |
|---|---|
| PubChem CID | 88928181 |
| Molecular Formula | C18H24BO4P2 |
| Molecular Weight | 377.15 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | — |
| SMILES | O=C1C[C@H]2C(C[C@@H](PP[B]O)[C@@H]2/C=C/[C@@H](O)CCc2ccccc2)O1 |
| InChI | InChI=1S/C18H24BO4P2/c20-13(7-6-12-4-2-1-3-5-12)8-9-14-15-10-18(21)23-16(15)11-17(14)24-25-19-22/h1-5,8-9,13-17,20,22,24-25H,6-7,10-11H2/b9-8+/t13-,14+,15+,16?,17+/m0/s1 |
| InChIKey | IOKZYRSOPIUQBA-WABSZDSASA-N |
| XLogP | 2.65 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.15 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|