C18H35BO4P2Si — CID 58785115
(3aR,4R,5R,6aS)-5-bis(phosphanyl)boranyloxy-4-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxypent-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 58785115) has the molecular formula C18H35BO4P2Si and a molecular weight of 416.32 g/mol. Its IUPAC name is (3aR,4R,5R,6aS)-5-bis(phosphanyl)boranyloxy-4-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxypent-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (3aR,4R,5R,6aS)-5-bis(phosphanyl)boranyloxy-4-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxypent-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 58785115 |
| Molecular Formula | C18H35BO4P2Si |
| Molecular Weight | 416.32 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | (3aR,4R,5R,6aS)-5-bis(phosphanyl)boranyloxy-4-[(E,3S)-3-[tert-butyl(dimethyl)silyl]oxypent-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | CC[C@@H](/C=C/[C@@H]1[C@H]2CC(=O)O[C@H]2C[C@H]1OB(P)P)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H35BO4P2Si/c1-7-12(23-26(5,6)18(2,3)4)8-9-13-14-10-17(20)21-15(14)11-16(13)22-19(24)25/h8-9,12-16H,7,10-11,24-25H2,1-6H3/b9-8+/t12-,13+,14+,15-,16+/m0/s1 |
| InChIKey | BYRAZAUOEFTOMV-UIZQWOHYSA-N |
| XLogP | 4.41 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.32 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|