C30H49BrO4Si2 — CID 10461370
(3aR,4R,5R,6aS)-4-[(E,3S)-5-(4-bromophenyl)-3-[tert-butyl(dimethyl)silyl]oxypent-1-enyl]-5-[tert-butyl(dimethyl)silyl]oxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 10461370) has the molecular formula C30H49BrO4Si2 and a molecular weight of 609.79 g/mol. Its IUPAC name is (3aR,4R,5R,6aS)-4-[(E,3S)-5-(4-bromophenyl)-3-[tert-butyl(dimethyl)silyl]oxypent-1-enyl]-5-[tert-butyl(dimethyl)silyl]oxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (3aR,4R,5R,6aS)-4-[(E,3S)-5-(4-bromophenyl)-3-[tert-butyl(dimethyl)silyl]oxypent-1-enyl]-5-[tert-butyl(dimethyl)silyl]oxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 10461370 |
| Molecular Formula | C30H49BrO4Si2 |
| Molecular Weight | 609.79 g/mol |
| Exact Mass | 608.24 |
| IUPAC Name | (3aR,4R,5R,6aS)-4-[(E,3S)-5-(4-bromophenyl)-3-[tert-butyl(dimethyl)silyl]oxypent-1-enyl]-5-[tert-butyl(dimethyl)silyl]oxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H](/C=C/[C@@H]1[C@H]2CC(=O)O[C@H]2C[C@H]1O[Si](C)(C)C(C)(C)C)CCc1ccc(Br)cc1 |
| InChI | InChI=1S/C30H49BrO4Si2/c1-29(2,3)36(7,8)34-23(16-13-21-11-14-22(31)15-12-21)17-18-24-25-19-28(32)33-26(25)20-27(24)35-37(9,10)30(4,5)6/h11-12,14-15,17-18,23-27H,13,16,19-20H2,1-10H3/b18-17+/t23-,24+,25+,26-,27+/m0/s1 |
| InChIKey | FDILDXRGYPRHFD-OJVCXAMZSA-N |
| XLogP | 8.67 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.79 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|