C29H55BrO2Si2 — CID 14123689
[(E)-1-[5-(bromomethyl)-2-[tert-butyl(dimethyl)silyl]oxy-1,2,3,3a,6,6a-hexahydropentalen-1-yl]oct-1-en-3-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 14123689) has the molecular formula C29H55BrO2Si2 and a molecular weight of 571.83 g/mol. Its IUPAC name is [(E)-1-[5-(bromomethyl)-2-[tert-butyl(dimethyl)silyl]oxy-1,2,3,3a,6,6a-hexahydropentalen-1-yl]oct-1-en-3-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(E)-1-[5-(bromomethyl)-2-[tert-butyl(dimethyl)silyl]oxy-1,2,3,3a,6,6a-hexahydropentalen-1-yl]oct-1-en-3-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 14123689 |
| Molecular Formula | C29H55BrO2Si2 |
| Molecular Weight | 571.83 g/mol |
| Exact Mass | 570.29 |
| IUPAC Name | [(E)-1-[5-(bromomethyl)-2-[tert-butyl(dimethyl)silyl]oxy-1,2,3,3a,6,6a-hexahydropentalen-1-yl]oct-1-en-3-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CCCCCC(/C=C/C1C(O[Si](C)(C)C(C)(C)C)CC2C=C(CBr)CC21)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H55BrO2Si2/c1-12-13-14-15-24(31-33(8,9)28(2,3)4)16-17-25-26-19-22(21-30)18-23(26)20-27(25)32-34(10,11)29(5,6)7/h16-18,23-27H,12-15,19-21H2,1-11H3/b17-16+ |
| InChIKey | UBKJRIPPTWNPGX-WUKNDPDISA-N |
| XLogP | 9.88 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.83 |
| LogP ≤ 5 | 9.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|