C32H62O2Si3 — CID 56616320
tert-butyl-[(3S)-1-[(1R,2R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-methylidene-2-(3-trimethylsilylprop-2-ynyl)cyclopentyl]oct-1-en-3-yl]oxy-dimethylsilane (PubChem CID 56616320) has the molecular formula C32H62O2Si3 and a molecular weight of 563.10 g/mol. Its IUPAC name is tert-butyl-[(3S)-1-[(1R,2R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-methylidene-2-(3-trimethylsilylprop-2-ynyl)cyclopentyl]oct-1-en-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(3S)-1-[(1R,2R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-methylidene-2-(3-trimethylsilylprop-2-ynyl)cyclopentyl]oct-1-en-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 56616320 |
| Molecular Formula | C32H62O2Si3 |
| Molecular Weight | 563.10 g/mol |
| Exact Mass | 562.41 |
| IUPAC Name | tert-butyl-[(3S)-1-[(1R,2R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-methylidene-2-(3-trimethylsilylprop-2-ynyl)cyclopentyl]oct-1-en-3-yl]oxy-dimethylsilane |
| SMILES | C=C1C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C=C[C@H](CCCCC)O[Si](C)(C)C(C)(C)C)[C@H]1CC#C[Si](C)(C)C |
| InChI | InChI=1S/C32H62O2Si3/c1-16-17-18-20-27(33-36(12,13)31(3,4)5)22-23-29-28(21-19-24-35(9,10)11)26(2)25-30(29)34-37(14,15)32(6,7)8/h22-23,27-30H,2,16-18,20-21,25H2,1,3-15H3/t27-,28-,29+,30+/m0/s1 |
| InChIKey | QIFAOOLGCMTTDW-VZNYXHRGSA-N |
| XLogP | 10.37 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.10 |
| LogP ≤ 5 | 10.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|