C21H40OSi2 — CID 11024906
tert-butyl-dimethyl-[(7E,9Z)-12-trimethylsilyldodeca-7,9-dien-11-yn-6-yl]oxysilane (PubChem CID 11024906) has the molecular formula C21H40OSi2 and a molecular weight of 364.72 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(7E,9Z)-12-trimethylsilyldodeca-7,9-dien-11-yn-6-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(7E,9Z)-12-trimethylsilyldodeca-7,9-dien-11-yn-6-yl]oxysilane |
|---|---|
| PubChem CID | 11024906 |
| Molecular Formula | C21H40OSi2 |
| Molecular Weight | 364.72 g/mol |
| Exact Mass | 364.26 |
| IUPAC Name | tert-butyl-dimethyl-[(7E,9Z)-12-trimethylsilyldodeca-7,9-dien-11-yn-6-yl]oxysilane |
| SMILES | CCCCCC(/C=C/C=C\C#C[Si](C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H40OSi2/c1-10-11-14-17-20(22-24(8,9)21(2,3)4)18-15-12-13-16-19-23(5,6)7/h12-13,15,18,20H,10-11,14,17H2,1-9H3/b13-12-,18-15+ |
| InChIKey | PVXWFVHHSGPBOH-PNYDDDKWSA-N |
| XLogP | 6.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.72 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|