C14H28O2Si — CID 71343055
4-[tert-butyl(dimethyl)silyl]oxyoct-2-enal (PubChem CID 71343055) has the molecular formula C14H28O2Si and a molecular weight of 256.46 g/mol. Its IUPAC name is 4-[tert-butyl(dimethyl)silyl]oxyoct-2-enal.
| Compound Name | 4-[tert-butyl(dimethyl)silyl]oxyoct-2-enal |
|---|---|
| PubChem CID | 71343055 |
| Molecular Formula | C14H28O2Si |
| Molecular Weight | 256.46 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | 4-[tert-butyl(dimethyl)silyl]oxyoct-2-enal |
| SMILES | CCCCC(C=CC=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H28O2Si/c1-7-8-10-13(11-9-12-15)16-17(5,6)14(2,3)4/h9,11-13H,7-8,10H2,1-6H3 |
| InChIKey | XOXHVXOUZQMQMQ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.46 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|