C27H56O2Si2 — CID 141158621
tert-butyl-[(5S,8E,10E,12R)-12-[tert-butyl(dimethyl)silyl]oxypentadeca-8,10-dien-5-yl]oxy-dimethylsilane (PubChem CID 141158621) has the molecular formula C27H56O2Si2 and a molecular weight of 468.92 g/mol. Its IUPAC name is tert-butyl-[(5S,8E,10E,12R)-12-[tert-butyl(dimethyl)silyl]oxypentadeca-8,10-dien-5-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(5S,8E,10E,12R)-12-[tert-butyl(dimethyl)silyl]oxypentadeca-8,10-dien-5-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 141158621 |
| Molecular Formula | C27H56O2Si2 |
| Molecular Weight | 468.92 g/mol |
| Exact Mass | 468.38 |
| IUPAC Name | tert-butyl-[(5S,8E,10E,12R)-12-[tert-butyl(dimethyl)silyl]oxypentadeca-8,10-dien-5-yl]oxy-dimethylsilane |
| SMILES | CCCC[C@@H](CC/C=C/C=C/[C@@H](CCC)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H56O2Si2/c1-13-15-21-25(29-31(11,12)27(6,7)8)23-19-17-16-18-22-24(20-14-2)28-30(9,10)26(3,4)5/h16-18,22,24-25H,13-15,19-21,23H2,1-12H3/b17-16+,22-18+/t24-,25+/m1/s1 |
| InChIKey | OYLRZIXJKZSIBT-AGEXODFMSA-N |
| XLogP | 9.65 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.92 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|