C14H31BO3Si — CID 129405347
[(E,4R)-4-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]boronic acid (PubChem CID 129405347) has the molecular formula C14H31BO3Si and a molecular weight of 286.30 g/mol. Its IUPAC name is [(E,4R)-4-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]boronic acid.
| Compound Name | [(E,4R)-4-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]boronic acid |
|---|---|
| PubChem CID | 129405347 |
| Molecular Formula | C14H31BO3Si |
| Molecular Weight | 286.30 g/mol |
| Exact Mass | 286.21 |
| IUPAC Name | [(E,4R)-4-[tert-butyl(dimethyl)silyl]oxyoct-1-enyl]boronic acid |
| SMILES | CCCC[C@H](C/C=C/B(O)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H31BO3Si/c1-7-8-10-13(11-9-12-15(16)17)18-19(5,6)14(2,3)4/h9,12-13,16-17H,7-8,10-11H2,1-6H3/b12-9+/t13-/m1/s1 |
| InChIKey | NJIXJSWSSAEZCZ-CNELAYHGSA-N |
| XLogP | 3.53 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.30 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|