C19H40OSi2 — CID 72549741
tert-butyl-dimethyl-[(5S)-1-trimethylsilyldec-1-yn-5-yl]oxysilane (PubChem CID 72549741) has the molecular formula C19H40OSi2 and a molecular weight of 340.70 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(5S)-1-trimethylsilyldec-1-yn-5-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(5S)-1-trimethylsilyldec-1-yn-5-yl]oxysilane |
|---|---|
| PubChem CID | 72549741 |
| Molecular Formula | C19H40OSi2 |
| Molecular Weight | 340.70 g/mol |
| Exact Mass | 340.26 |
| IUPAC Name | tert-butyl-dimethyl-[(5S)-1-trimethylsilyldec-1-yn-5-yl]oxysilane |
| SMILES | CCCCC[C@@H](CCC#C[Si](C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H40OSi2/c1-10-11-12-15-18(16-13-14-17-21(5,6)7)20-22(8,9)19(2,3)4/h18H,10-13,15-16H2,1-9H3/t18-/m0/s1 |
| InChIKey | AWKPSCQESKDKMT-SFHVURJKSA-N |
| XLogP | 6.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.70 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|