C27H54O3Si — CID 57257200
tert-butyl-dimethyl-[1-(5-oxabicyclo[2.1.1]hexan-6-yloxy)hexadecan-7-yloxy]silane (PubChem CID 57257200) has the molecular formula C27H54O3Si and a molecular weight of 454.81 g/mol. Its IUPAC name is tert-butyl-dimethyl-[1-(5-oxabicyclo[2.1.1]hexan-6-yloxy)hexadecan-7-yloxy]silane.
| Compound Name | tert-butyl-dimethyl-[1-(5-oxabicyclo[2.1.1]hexan-6-yloxy)hexadecan-7-yloxy]silane |
|---|---|
| PubChem CID | 57257200 |
| Molecular Formula | C27H54O3Si |
| Molecular Weight | 454.81 g/mol |
| Exact Mass | 454.38 |
| IUPAC Name | tert-butyl-dimethyl-[1-(5-oxabicyclo[2.1.1]hexan-6-yloxy)hexadecan-7-yloxy]silane |
| SMILES | CCCCCCCCCC(CCCCCCOC1C2CCC1O2)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H54O3Si/c1-7-8-9-10-11-12-15-18-23(30-31(5,6)27(2,3)4)19-16-13-14-17-22-28-26-24-20-21-25(26)29-24/h23-26H,7-22H2,1-6H3 |
| InChIKey | WSIRPOYQGMPYMT-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.81 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|