C21H42O3Si — CID 57132443
tert-butyl-dimethyl-[10-(5-oxabicyclo[2.1.1]hexan-6-yloxy)decan-4-yloxy]silane (PubChem CID 57132443) has the molecular formula C21H42O3Si and a molecular weight of 370.65 g/mol. Its IUPAC name is tert-butyl-dimethyl-[10-(5-oxabicyclo[2.1.1]hexan-6-yloxy)decan-4-yloxy]silane.
| Compound Name | tert-butyl-dimethyl-[10-(5-oxabicyclo[2.1.1]hexan-6-yloxy)decan-4-yloxy]silane |
|---|---|
| PubChem CID | 57132443 |
| Molecular Formula | C21H42O3Si |
| Molecular Weight | 370.65 g/mol |
| Exact Mass | 370.29 |
| IUPAC Name | tert-butyl-dimethyl-[10-(5-oxabicyclo[2.1.1]hexan-6-yloxy)decan-4-yloxy]silane |
| SMILES | CCCC(CCCCCCOC1C2CCC1O2)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H42O3Si/c1-7-12-17(24-25(5,6)21(2,3)4)13-10-8-9-11-16-22-20-18-14-15-19(20)23-18/h17-20H,7-16H2,1-6H3 |
| InChIKey | XDOGZUFUSONQMA-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.65 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|