C27H52O3Si — CID 174059908
[(Z)-12-[tert-butyl(dimethyl)silyl]oxyoctadec-9-enyl] prop-2-enoate (PubChem CID 174059908) has the molecular formula C27H52O3Si and a molecular weight of 452.80 g/mol. Its IUPAC name is [(Z)-12-[tert-butyl(dimethyl)silyl]oxyoctadec-9-enyl] prop-2-enoate.
| Compound Name | [(Z)-12-[tert-butyl(dimethyl)silyl]oxyoctadec-9-enyl] prop-2-enoate |
|---|---|
| PubChem CID | 174059908 |
| Molecular Formula | C27H52O3Si |
| Molecular Weight | 452.80 g/mol |
| Exact Mass | 452.37 |
| IUPAC Name | [(Z)-12-[tert-butyl(dimethyl)silyl]oxyoctadec-9-enyl] prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCCCC/C=C\CC(CCCCCC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H52O3Si/c1-8-10-11-19-22-25(30-31(6,7)27(3,4)5)23-20-17-15-13-12-14-16-18-21-24-29-26(28)9-2/h9,17,20,25H,2,8,10-16,18-19,21-24H2,1,3-7H3/b20-17- |
| InChIKey | CYOXPNXVZMSXDO-JZJYNLBNSA-N |
| XLogP | 8.75 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.80 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|