C23H52O4Si2 — CID 102059206
(2S,3S,5S)-2-butyl-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]heptane-1,7-diol (PubChem CID 102059206) has the molecular formula C23H52O4Si2 and a molecular weight of 448.84 g/mol. Its IUPAC name is (2S,3S,5S)-2-butyl-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]heptane-1,7-diol.
| Compound Name | (2S,3S,5S)-2-butyl-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]heptane-1,7-diol |
|---|---|
| PubChem CID | 102059206 |
| Molecular Formula | C23H52O4Si2 |
| Molecular Weight | 448.84 g/mol |
| Exact Mass | 448.34 |
| IUPAC Name | (2S,3S,5S)-2-butyl-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]heptane-1,7-diol |
| SMILES | CCCCC(CO)[C@H](C[C@H](CCO)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H52O4Si2/c1-12-13-14-19(18-25)21(27-29(10,11)23(5,6)7)17-20(15-16-24)26-28(8,9)22(2,3)4/h19-21,24-25H,12-18H2,1-11H3/t19?,20-,21-/m0/s1 |
| InChIKey | WHXYSOSWFQNFDH-AKQSQHNNSA-N |
| XLogP | 6.34 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.84 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|