C18H39IOSi — CID 15315171
tert-butyl-[(6R,7S)-7-iodododecan-6-yl]oxy-dimethylsilane (PubChem CID 15315171) has the molecular formula C18H39IOSi and a molecular weight of 426.50 g/mol. Its IUPAC name is tert-butyl-[(6R,7S)-7-iodododecan-6-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(6R,7S)-7-iodododecan-6-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 15315171 |
| Molecular Formula | C18H39IOSi |
| Molecular Weight | 426.50 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | tert-butyl-[(6R,7S)-7-iodododecan-6-yl]oxy-dimethylsilane |
| SMILES | CCCCC[C@H](I)[C@@H](CCCCC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H39IOSi/c1-8-10-12-14-16(19)17(15-13-11-9-2)20-21(6,7)18(3,4)5/h16-17H,8-15H2,1-7H3/t16-,17+/m0/s1 |
| InChIKey | GAEIWQINHGTNME-DLBZAZTESA-N |
| XLogP | 7.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.50 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|