C31H68O2Si3 — CID 101415913
tert-butyl-dimethyl-[(Z,1S,2S)-1-pentyl-3-trimethylsilyl-2-tri(propan-2-yl)silyloxyoct-3-enoxy]silane (PubChem CID 101415913) has the molecular formula C31H68O2Si3 and a molecular weight of 557.14 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(Z,1S,2S)-1-pentyl-3-trimethylsilyl-2-tri(propan-2-yl)silyloxyoct-3-enoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(Z,1S,2S)-1-pentyl-3-trimethylsilyl-2-tri(propan-2-yl)silyloxyoct-3-enoxy]silane |
|---|---|
| PubChem CID | 101415913 |
| Molecular Formula | C31H68O2Si3 |
| Molecular Weight | 557.14 g/mol |
| Exact Mass | 556.45 |
| IUPAC Name | tert-butyl-dimethyl-[(Z,1S,2S)-1-pentyl-3-trimethylsilyl-2-tri(propan-2-yl)silyloxyoct-3-enoxy]silane |
| SMILES | CCCC/C=C(/[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@H](CCCCC)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C31H68O2Si3/c1-17-19-21-23-28(32-35(15,16)31(9,10)11)30(29(34(12,13)14)24-22-20-18-2)33-36(25(3)4,26(5)6)27(7)8/h24-28,30H,17-23H2,1-16H3/b29-24-/t28-,30-/m0/s1 |
| InChIKey | GKCKCEGAUWPDFZ-NCWZPUEPSA-N |
| XLogP | 11.51 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.14 |
| LogP ≤ 5 | 11.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|