C19H40OSi — CID 11045214
tert-butyl-dimethyl-[(3S,4R)-2-methyl-4-(2-methylprop-1-enyl)octan-3-yl]oxysilane (PubChem CID 11045214) has the molecular formula C19H40OSi and a molecular weight of 312.61 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(3S,4R)-2-methyl-4-(2-methylprop-1-enyl)octan-3-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(3S,4R)-2-methyl-4-(2-methylprop-1-enyl)octan-3-yl]oxysilane |
|---|---|
| PubChem CID | 11045214 |
| Molecular Formula | C19H40OSi |
| Molecular Weight | 312.61 g/mol |
| Exact Mass | 312.28 |
| IUPAC Name | tert-butyl-dimethyl-[(3S,4R)-2-methyl-4-(2-methylprop-1-enyl)octan-3-yl]oxysilane |
| SMILES | CCCC[C@H](C=C(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)C(C)C |
| InChI | InChI=1S/C19H40OSi/c1-11-12-13-17(14-15(2)3)18(16(4)5)20-21(9,10)19(6,7)8/h14,16-18H,11-13H2,1-10H3/t17-,18+/m1/s1 |
| InChIKey | WNRCXNOHANIOHX-MSOLQXFVSA-N |
| XLogP | 6.81 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.61 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|