C25H48O2Si — CID 11004104
(7R,8R)-7-[tert-butyl(dimethyl)silyl]oxy-2-methyloctadec-2-en-5-yn-8-ol (PubChem CID 11004104) has the molecular formula C25H48O2Si and a molecular weight of 408.74 g/mol. Its IUPAC name is (7R,8R)-7-[tert-butyl(dimethyl)silyl]oxy-2-methyloctadec-2-en-5-yn-8-ol.
| Compound Name | (7R,8R)-7-[tert-butyl(dimethyl)silyl]oxy-2-methyloctadec-2-en-5-yn-8-ol |
|---|---|
| PubChem CID | 11004104 |
| Molecular Formula | C25H48O2Si |
| Molecular Weight | 408.74 g/mol |
| Exact Mass | 408.34 |
| IUPAC Name | (7R,8R)-7-[tert-butyl(dimethyl)silyl]oxy-2-methyloctadec-2-en-5-yn-8-ol |
| SMILES | CCCCCCCCCC[C@@H](O)[C@@H](C#CCC=C(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H48O2Si/c1-9-10-11-12-13-14-15-16-20-23(26)24(21-18-17-19-22(2)3)27-28(7,8)25(4,5)6/h19,23-24,26H,9-17,20H2,1-8H3/t23-,24-/m1/s1 |
| InChIKey | FHAOYAXUBWPPMF-DNQXCXABSA-N |
| XLogP | 7.63 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.74 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|