C29H54O3Si2 — CID 102372663
(8R,9R,15R)-9,15-bis[[tert-butyl(dimethyl)silyl]oxy]heptadec-16-en-11,13-diyn-8-ol (PubChem CID 102372663) has the molecular formula C29H54O3Si2 and a molecular weight of 506.92 g/mol. Its IUPAC name is (8R,9R,15R)-9,15-bis[[tert-butyl(dimethyl)silyl]oxy]heptadec-16-en-11,13-diyn-8-ol.
| Compound Name | (8R,9R,15R)-9,15-bis[[tert-butyl(dimethyl)silyl]oxy]heptadec-16-en-11,13-diyn-8-ol |
|---|---|
| PubChem CID | 102372663 |
| Molecular Formula | C29H54O3Si2 |
| Molecular Weight | 506.92 g/mol |
| Exact Mass | 506.36 |
| IUPAC Name | (8R,9R,15R)-9,15-bis[[tert-butyl(dimethyl)silyl]oxy]heptadec-16-en-11,13-diyn-8-ol |
| SMILES | C=C[C@H](C#CC#CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)CCCCCCC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H54O3Si2/c1-13-15-16-17-20-23-26(30)27(32-34(11,12)29(6,7)8)24-21-18-19-22-25(14-2)31-33(9,10)28(3,4)5/h14,25-27,30H,2,13,15-17,20,23-24H2,1,3-12H3/t25-,26-,27-/m1/s1 |
| InChIKey | LVQQLSTWCIQQPD-ZONZVBGPSA-N |
| XLogP | 8.07 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.92 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|