C18H28O3 — CID 16656203
(3R,9S,10S)-10-methoxyheptadec-1-en-4,6-diyne-3,9-diol (PubChem CID 16656203) has the molecular formula C18H28O3 and a molecular weight of 292.42 g/mol. Its IUPAC name is (3R,9S,10S)-10-methoxyheptadec-1-en-4,6-diyne-3,9-diol.
| Compound Name | (3R,9S,10S)-10-methoxyheptadec-1-en-4,6-diyne-3,9-diol |
|---|---|
| PubChem CID | 16656203 |
| Molecular Formula | C18H28O3 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | (3R,9S,10S)-10-methoxyheptadec-1-en-4,6-diyne-3,9-diol |
| SMILES | C=C[C@@H](O)C#CC#CC[C@H](O)[C@H](CCCCCCC)OC |
| InChI | InChI=1S/C18H28O3/c1-4-6-7-8-12-15-18(21-3)17(20)14-11-9-10-13-16(19)5-2/h5,16-20H,2,4,6-8,12,14-15H2,1,3H3/t16-,17+,18+/m1/s1 |
| InChIKey | QSLYECSTHSYXDL-SQNIBIBYSA-N |
| XLogP | 2.67 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|