C21H35NO — CID 71761408
(3S,8R)-8-(butylamino)heptadec-1-en-4,6-diyn-3-ol (PubChem CID 71761408) has the molecular formula C21H35NO and a molecular weight of 317.52 g/mol. Its IUPAC name is (3S,8R)-8-(butylamino)heptadec-1-en-4,6-diyn-3-ol.
| Compound Name | (3S,8R)-8-(butylamino)heptadec-1-en-4,6-diyn-3-ol |
|---|---|
| PubChem CID | 71761408 |
| Molecular Formula | C21H35NO |
| Molecular Weight | 317.52 g/mol |
| Exact Mass | 317.27 |
| IUPAC Name | (3S,8R)-8-(butylamino)heptadec-1-en-4,6-diyn-3-ol |
| SMILES | C=C[C@H](O)C#CC#C[C@@H](CCCCCCCCC)NCCCC |
| InChI | InChI=1S/C21H35NO/c1-4-7-9-10-11-12-13-16-20(22-19-8-5-2)17-14-15-18-21(23)6-3/h6,20-23H,3-5,7-13,16,19H2,1-2H3/t20-,21+/m1/s1 |
| InChIKey | ASHBUPSMMOPFQN-RTWAWAEBSA-N |
| XLogP | 4.44 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.52 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|