C23H37NO2 — CID 71761360
(3S,8R)-8-(butylamino)-3-ethenylheptadeca-4,6-diynoic acid (PubChem CID 71761360) has the molecular formula C23H37NO2 and a molecular weight of 359.55 g/mol. Its IUPAC name is (3S,8R)-8-(butylamino)-3-ethenylheptadeca-4,6-diynoic acid.
| Compound Name | (3S,8R)-8-(butylamino)-3-ethenylheptadeca-4,6-diynoic acid |
|---|---|
| PubChem CID | 71761360 |
| Molecular Formula | C23H37NO2 |
| Molecular Weight | 359.55 g/mol |
| Exact Mass | 359.28 |
| IUPAC Name | (3S,8R)-8-(butylamino)-3-ethenylheptadeca-4,6-diynoic acid |
| SMILES | C=C[C@@H](C#CC#C[C@@H](CCCCCCCCC)NCCCC)CC(=O)O |
| InChI | InChI=1S/C23H37NO2/c1-4-7-9-10-11-12-13-17-22(24-19-8-5-2)18-15-14-16-21(6-3)20-23(25)26/h6,21-22,24H,3-5,7-13,17,19-20H2,1-2H3,(H,25,26)/t21-,22+/m0/s1 |
| InChIKey | MHJCKXKLEPLNRG-FCHUYYIVSA-N |
| XLogP | 5.17 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.55 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|