C17H24O — CID 87603284
(8E)-heptadeca-1,8-dien-4,6-diyn-3-ol (PubChem CID 87603284) has the molecular formula C17H24O and a molecular weight of 244.38 g/mol. Its IUPAC name is (8E)-heptadeca-1,8-dien-4,6-diyn-3-ol.
| Compound Name | (8E)-heptadeca-1,8-dien-4,6-diyn-3-ol |
|---|---|
| PubChem CID | 87603284 |
| Molecular Formula | C17H24O |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | (8E)-heptadeca-1,8-dien-4,6-diyn-3-ol |
| SMILES | C=CC(O)C#CC#C/C=C/CCCCCCCC |
| InChI | InChI=1S/C17H24O/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17(18)4-2/h4,11-12,17-18H,2-3,5-10H2,1H3/b12-11+ |
| InChIKey | QMLGDAUWIFWXPW-VAWYXSNFSA-N |
| XLogP | 3.85 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|