C10H10O2 — CID 90656893
(2Z)-deca-2,9-dien-4,6-diyne-1,8-diol (PubChem CID 90656893) has the molecular formula C10H10O2 and a molecular weight of 162.19 g/mol. Its IUPAC name is (2Z)-deca-2,9-dien-4,6-diyne-1,8-diol.
| Compound Name | (2Z)-deca-2,9-dien-4,6-diyne-1,8-diol |
|---|---|
| PubChem CID | 90656893 |
| Molecular Formula | C10H10O2 |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.07 |
| IUPAC Name | (2Z)-deca-2,9-dien-4,6-diyne-1,8-diol |
| SMILES | C=CC(O)C#CC#C/C=C\CO |
| InChI | InChI=1S/C10H10O2/c1-2-10(12)8-6-4-3-5-7-9-11/h2,5,7,10-12H,1,9H2/b7-5- |
| InChIKey | BAULTANCNGCCJT-ALCCZGGFSA-N |
| XLogP | 0.09 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|