C13H10O3 — CID 162872324
tridec-11-en-3,5,7,9-tetrayne-1,2,13-triol (PubChem CID 162872324) has the molecular formula C13H10O3 and a molecular weight of 214.22 g/mol. Its IUPAC name is tridec-11-en-3,5,7,9-tetrayne-1,2,13-triol.
| Compound Name | tridec-11-en-3,5,7,9-tetrayne-1,2,13-triol |
|---|---|
| PubChem CID | 162872324 |
| Molecular Formula | C13H10O3 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | tridec-11-en-3,5,7,9-tetrayne-1,2,13-triol |
| SMILES | OCC=CC#CC#CC#CC#CC(O)CO |
| InChI | InChI=1S/C13H10O3/c14-11-9-7-5-3-1-2-4-6-8-10-13(16)12-15/h7,9,13-16H,11-12H2 |
| InChIKey | ULMPLBPXLHXGIC-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|